Compound Q&A

How is (2S)-(2-Chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetic acid hydrochloride (CAS: 144750-42-5) typically synthesized?

Answer

(2S)-(2-Chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetic acid hydrochloride (1:1)
The compound is typically synthesized via a multi-step process involving the reaction of a 2-chlorophenyl derivative with 6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetic acid. Commonly, palladium catalysts are used for the coupling reaction, with high selectivity and good yields. The final step involves the addition of hydrochloric acid to form the hydrochloride salt.

About

English Name (2S)-(2-Chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetic acid hydrochloride (1:1)
Molecular Formula C15H15Cl2NO2S
Molecular Weight 344.26 g/mol
SMILES c1ccc(c(c1)[C@@H](C(=O)O)N2CCc3c(ccs3)C2)Cl.Cl
InChIKey FOKSIOUPGDBSLC-UQKRIMTDSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-(2-Chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetic acid hydrochloride (CAS: 144750-42-5)?

This compound has a crystalline form and a molecular weight of approximately 395.73 g/mol. It is spa...

Compound Q&A

What industries use (2S)-(2-Chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetic acid hydrochloride (CAS: 144750-42-5)?

This compound is used in the pharmaceutical industry for its potential as a drug candidate. It is al...

Compound Q&A

What precautions should be taken when handling (2S)-(2-Chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetic acid hydrochloride (CAS: 144750-42-5)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves and safe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...