Compound Q&A

How is 3,5-Dinitrobenzamide (CAS: 121-81-3) typically synthesized?

Answer

3,5-Dinitrobenzamide
3,5-Dinitrobenzamide (CAS: 121-81-3) is typically synthesized by the nitration of benzamide using concentrated nitric acid and sulfuric acid as the nitrating agent. The process involves the formation of the intermediate nitro compound, which is then amided with benzamide. The reaction is carried out under mild conditions to improve selectivity and yield.

About

CAS No 121-81-3
English Name 3,5-Dinitrobenzamide
Molecular Formula C7H5N3O5
Molecular Weight 211.13 g/mol
SMILES C1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)N
InChIKey UUKWKUSGGZNXGA-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-Dinitrobenzamide (CAS: 121-81-3)?

3,5-Dinitrobenzamide (CAS: 121-81-3) is a white crystalline solid with a molecular weight of 212.09 ...

Compound Q&A

What industries use 3,5-Dinitrobenzamide (CAS: 121-81-3)?

3,5-Dinitrobenzamide (CAS: 121-81-3) is used in the pharmaceutical industry for the synthesis of cer...

Compound Q&A

What precautions should be taken when handling 3,5-Dinitrobenzamide (CAS: 121-81-3)?

When handling 3,5-Dinitrobenzamide (CAS: 121-81-3), it is essential to use personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...