Compound Q&A

What are the physical and chemical properties of 3,5-Dinitrobenzamide (CAS: 121-81-3)?

Answer

3,5-Dinitrobenzamide
3,5-Dinitrobenzamide (CAS: 121-81-3) is a white crystalline solid with a molecular weight of 212.09 g/mol. It is poorly soluble in water but soluble in organic solvents such as ethanol and acetone. Chemically, it is relatively stable but can react with reducing agents. Its solubility and reactivity make it useful in various synthesis processes.

About

CAS No 121-81-3
English Name 3,5-Dinitrobenzamide
Molecular Formula C7H5N3O5
Molecular Weight 211.13 g/mol
SMILES C1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)N
InChIKey UUKWKUSGGZNXGA-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

How is 3,5-Dinitrobenzamide (CAS: 121-81-3) typically synthesized?

3,5-Dinitrobenzamide (CAS: 121-81-3) is typically synthesized by the nitration of benzamide using co...

Compound Q&A

What industries use 3,5-Dinitrobenzamide (CAS: 121-81-3)?

3,5-Dinitrobenzamide (CAS: 121-81-3) is used in the pharmaceutical industry for the synthesis of cer...

Compound Q&A

What precautions should be taken when handling 3,5-Dinitrobenzamide (CAS: 121-81-3)?

When handling 3,5-Dinitrobenzamide (CAS: 121-81-3), it is essential to use personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...