Compound Q&A

What industries use 4-Nitro-1H-pyrrolo[2,3-b]pyridine (CAS: 83683-82-3)?

Answer

4-Nitro-1H-pyrrolo[2,3-b]pyridine
4-Nitro-1H-pyrrolo[2,3-b]pyridine (CAS: 83683-82-3) is used in the pharmaceutical and chemical manufacturing industries for its potential applications in drug synthesis and as a precursor for other compounds. It is also explored in sensor technology and semiconductor manufacturing for its unique electronic properties.

About

CAS No 83683-82-3
English Name 4-Nitro-1H-pyrrolo[2,3-b]pyridine
Molecular Formula C7H5N3O2
Molecular Weight 163.13 g/mol
SMILES [O-][N+](=O)c1ccnc2c1cc[nH]2
InChIKey ULDUNXDRDOJMJZ-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Nitro-1H-pyrrolo[2,3-b]pyridine (CAS: 83683-82-3)?

4-Nitro-1H-pyrrolo[2,3-b]pyridine (CAS: 83683-82-3) is a crystalline solid with a molecular weight o...

Compound Q&A

How is 4-Nitro-1H-pyrrolo[2,3-b]pyridine (CAS: 83683-82-3) typically synthesized?

4-Nitro-1H-pyrrolo[2,3-b]pyridine (CAS: 83683-82-3) is commonly synthesized by the nitration of 1H-p...

Compound Q&A

What precautions should be taken when handling 4-Nitro-1H-pyrrolo[2,3-b]pyridine (CAS: 83683-82-3)?

When handling 4-Nitro-1H-pyrrolo[2,3-b]pyridine (CAS: 83683-82-3), it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...