Compound Q&A

What industries use 2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2)?

Answer

2,2'-Bipyridine - dichloropalladium (1:1)
2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2) is used in various industries, particularly in catalysis, where it serves as a catalyst in organic reactions. It is also utilized in the preparation of other complexes and in the development of new materials in fields such as semiconductors, sensors, and pharmaceuticals. Its role in polymer chemistry and as a ligand in coordination chemistry further expands its applications.

About

CAS No 14871-92-2
English Name 2,2'-Bipyridine - dichloropalladium (1:1)
Molecular Formula C10H8Cl2N2Pd
Molecular Weight 333.51 g/mol
SMILES C1=CC=NC(=C1)C2=CC=CC=N2.Cl[Pd]Cl
InChIKey MUNARLQNCCGPQU-UHFFFAOYSA-L
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2)?

2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2) is a complex of palladium and 2,2'-bipyr...

Compound Q&A

How is 2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2) typically synthesized?

2,2'-Bipyridine - dichloropalladium (1:1) is synthesized by reacting 2,2'-bipyridine with palladium(...

Compound Q&A

What precautions should be taken when handling 2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2)?

When handling 2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2), ensure proper Personal Pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...