Compound Q&A

What are the physical and chemical properties of 2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2)?

Answer

2,2'-Bipyridine - dichloropalladium (1:1)
2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2) is a complex of palladium and 2,2'-bipyridine. It is typically a yellow solid with a crystalline form. The molecular weight is approximately 428.95 g/mol. It has low water solubility but good solubility in organic solvents like DMF and DMSO. This compound is highly reactive, serving as a catalyst in various organic reactions.

About

CAS No 14871-92-2
English Name 2,2'-Bipyridine - dichloropalladium (1:1)
Molecular Formula C10H8Cl2N2Pd
Molecular Weight 333.51 g/mol
SMILES C1=CC=NC(=C1)C2=CC=CC=N2.Cl[Pd]Cl
InChIKey MUNARLQNCCGPQU-UHFFFAOYSA-L
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

How is 2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2) typically synthesized?

2,2'-Bipyridine - dichloropalladium (1:1) is synthesized by reacting 2,2'-bipyridine with palladium(...

Compound Q&A

What industries use 2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2)?

2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2) is used in various industries, particula...

Compound Q&A

What precautions should be taken when handling 2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2)?

When handling 2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2), ensure proper Personal Pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...