Compound Q&A

How is 2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2) typically synthesized?

Answer

2,2'-Bipyridine - dichloropalladium (1:1)
2,2'-Bipyridine - dichloropalladium (1:1) is synthesized by reacting 2,2'-bipyridine with palladium(II) chloride in an appropriate solvent. The reaction involves the formation of a complex where each palladium atom is coordinated with two bipyridine ligands. Common solvents include DMF or DMSO. The yield is typically good, and the product is isolated by filtration and recrystallization.

About

CAS No 14871-92-2
English Name 2,2'-Bipyridine - dichloropalladium (1:1)
Molecular Formula C10H8Cl2N2Pd
Molecular Weight 333.51 g/mol
SMILES C1=CC=NC(=C1)C2=CC=CC=N2.Cl[Pd]Cl
InChIKey MUNARLQNCCGPQU-UHFFFAOYSA-L
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2)?

2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2) is a complex of palladium and 2,2'-bipyr...

Compound Q&A

What industries use 2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2)?

2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2) is used in various industries, particula...

Compound Q&A

What precautions should be taken when handling 2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2)?

When handling 2,2'-Bipyridine - dichloropalladium (1:1) (CAS: 14871-92-2), ensure proper Personal Pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...