Compound Q&A

What industries use 2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate (CAS: 135716-09-5)?

Answer

2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate
2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate is primarily used in the pharmaceutical industry as a precursor for synthesizing complex organic molecules. It is also utilized in the polymer industry for the development of functional polymers. Additionally, it has potential applications in the production of sensors and semiconductors due to its chemical reactivity and stability under various conditions.

About

English Name 2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate
Molecular Formula C14H25NO4
Molecular Weight 271.36 g/mol
SMILES CCOC(=O)CC1CCN(CC1)C(=O)OC(C)(C)C
InChIKey PQEXLIRUMIRSAL-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate (CAS: 135716-09-5)?

2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate is a colorless to slightly yello...

Compound Q&A

How is 2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate (CAS: 135716-09-5) typically synthesized?

2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate is typically synthesized via a m...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate (CAS: 135716-09-5)?

When handling 2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate, it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...