Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate (CAS: 135716-09-5)?

Answer

2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate
2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate is a colorless to slightly yellowish crystalline solid with a molecular weight of approximately 322.35 g/mol. It is slightly soluble in water but soluble in common organic solvents like ethanol and acetone. The compound is relatively stable under normal conditions but reacts with strong bases to form the corresponding salts. It is also known for its reactivity with nucleophiles.

About

English Name 2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate
Molecular Formula C14H25NO4
Molecular Weight 271.36 g/mol
SMILES CCOC(=O)CC1CCN(CC1)C(=O)OC(C)(C)C
InChIKey PQEXLIRUMIRSAL-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate (CAS: 135716-09-5) typically synthesized?

2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate is typically synthesized via a m...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate (CAS: 135716-09-5)?

2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate is primarily used in the pharmac...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate (CAS: 135716-09-5)?

When handling 2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate, it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...