Compound Q&A

How is 2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate (CAS: 135716-09-5) typically synthesized?

Answer

2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate
2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate is typically synthesized via a multistep process involving the condensation of an ethyl 4-bromomethyl-1-piperidinecarboxylate with 2-methylpropyl alcohol, followed by the addition of ethoxyacetaldehyde. This reaction is often catalyzed by a Lewis acid such as zinc chloride, and the final product is isolated by recrystallization. The overall yield is moderate, around 50-60%, depending on the purity of the starting materials and reaction conditions.

About

English Name 2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate
Molecular Formula C14H25NO4
Molecular Weight 271.36 g/mol
SMILES CCOC(=O)CC1CCN(CC1)C(=O)OC(C)(C)C
InChIKey PQEXLIRUMIRSAL-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate (CAS: 135716-09-5)?

2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate is a colorless to slightly yello...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate (CAS: 135716-09-5)?

2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate is primarily used in the pharmac...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate (CAS: 135716-09-5)?

When handling 2-Methyl-2-propanyl 4-(2-ethoxy-2-oxoethyl)-1-piperidinecarboxylate, it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...