Compound Q&A

What precautions should be taken when handling 1,3-Dimethyluric acid (CAS: 944-73-0)?

Answer

1,3-Dimethyluric acid
When handling 1,3-Dimethyluric acid (CAS: 944-73-0), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The substance should be stored in a dry, well-ventilated area away from heat and open flames. Spills should be cleaned up using appropriate absorbents, and the area should be ventilated. Safety data sheets (SDS) should be consulted for detailed safety information.

About

CAS No 944-73-0
English Name 1,3-Dimethyluric acid
Molecular Formula C7H8N4O3
Molecular Weight 196.17 g/mol
SMILES CN1C2=C(C(=O)N(C1=O)C)NC(=O)N2
InChIKey OTSBKHHWSQYEHK-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-Dimethyluric acid (CAS: 944-73-0)?

1,3-Dimethyluric acid (CAS: 944-73-0) is a white crystalline solid with a molecular weight of 150.15...

Compound Q&A

How is 1,3-Dimethyluric acid (CAS: 944-73-0) typically synthesized?

1,3-Dimethyluric acid can be synthesized from 1,3-dimethyluric anhydride via hydrolysis under acidic...

Compound Q&A

What industries use 1,3-Dimethyluric acid (CAS: 944-73-0)?

1,3-Dimethyluric acid (CAS: 944-73-0) is primarily used in the pharmaceutical industry as an interme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...