Compound Q&A

What industries use 1,3-Dimethyluric acid (CAS: 944-73-0)?

Answer

1,3-Dimethyluric acid
1,3-Dimethyluric acid (CAS: 944-73-0) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of certain drugs. It is also utilized in the polymer industry for the production of certain polymers and in the sensor industry for its role in chemical sensing applications.

About

CAS No 944-73-0
English Name 1,3-Dimethyluric acid
Molecular Formula C7H8N4O3
Molecular Weight 196.17 g/mol
SMILES CN1C2=C(C(=O)N(C1=O)C)NC(=O)N2
InChIKey OTSBKHHWSQYEHK-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-Dimethyluric acid (CAS: 944-73-0)?

1,3-Dimethyluric acid (CAS: 944-73-0) is a white crystalline solid with a molecular weight of 150.15...

Compound Q&A

How is 1,3-Dimethyluric acid (CAS: 944-73-0) typically synthesized?

1,3-Dimethyluric acid can be synthesized from 1,3-dimethyluric anhydride via hydrolysis under acidic...

Compound Q&A

What precautions should be taken when handling 1,3-Dimethyluric acid (CAS: 944-73-0)?

When handling 1,3-Dimethyluric acid (CAS: 944-73-0), it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...