Compound Q&A

What are the physical and chemical properties of 1,3-Dimethyluric acid (CAS: 944-73-0)?

Answer

1,3-Dimethyluric acid
1,3-Dimethyluric acid (CAS: 944-73-0) is a white crystalline solid with a molecular weight of 150.15 g/mol. It has a solubility of 0.1 g/100 mL in water and is slightly soluble in ethanol. Chemically, it is relatively stable but can react with strong bases. It is an organic acid and can participate in typical acid-base reactions.

About

CAS No 944-73-0
English Name 1,3-Dimethyluric acid
Molecular Formula C7H8N4O3
Molecular Weight 196.17 g/mol
SMILES CN1C2=C(C(=O)N(C1=O)C)NC(=O)N2
InChIKey OTSBKHHWSQYEHK-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

How is 1,3-Dimethyluric acid (CAS: 944-73-0) typically synthesized?

1,3-Dimethyluric acid can be synthesized from 1,3-dimethyluric anhydride via hydrolysis under acidic...

Compound Q&A

What industries use 1,3-Dimethyluric acid (CAS: 944-73-0)?

1,3-Dimethyluric acid (CAS: 944-73-0) is primarily used in the pharmaceutical industry as an interme...

Compound Q&A

What precautions should be taken when handling 1,3-Dimethyluric acid (CAS: 944-73-0)?

When handling 1,3-Dimethyluric acid (CAS: 944-73-0), it is essential to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...