Compound Q&A

What industries use 2-Fluoro-4-nitroanisole (CAS: 455-93-6)?

Answer

2-Fluoro-4-nitroanisole
2-Fluoro-4-nitroanisole (CAS: 455-93-6) is used in various industries, particularly in pharmaceuticals and organic synthesis. It serves as a precursor in the development of drugs and as a reagent in the synthesis of other organic compounds. Additionally, it has applications in the production of dyes and in the development of certain materials for sensors and semiconductors.

About

CAS No 455-93-6
English Name 2-Fluoro-4-nitroanisole
Molecular Formula C7H6FNO3
Molecular Weight 171.13 g/mol
SMILES COC1=C(C=C(C=C1)[N+](=O)[O-])F
InChIKey XGMVTXUXZUPGGY-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-4-nitroanisole (CAS: 455-93-6)?

2-Fluoro-4-nitroanisole (CAS: 455-93-6) is a crystalline solid with a molecular weight of approximat...

Compound Q&A

How is 2-Fluoro-4-nitroanisole (CAS: 455-93-6) typically synthesized?

2-Fluoro-4-nitroanisole (CAS: 455-93-6) is synthesized via the nitration of 2-fluoroanisole. This is...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-4-nitroanisole (CAS: 455-93-6)?

When handling 2-Fluoro-4-nitroanisole (CAS: 455-93-6), it is crucial to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...