Compound Q&A

What are the physical and chemical properties of 2-Fluoro-4-nitroanisole (CAS: 455-93-6)?

Answer

2-Fluoro-4-nitroanisole
2-Fluoro-4-nitroanisole (CAS: 455-93-6) is a crystalline solid with a molecular weight of approximately 213.05 g/mol. It has a low solubility in water (0.4 g/100 mL at 25°C) but is more soluble in organic solvents like ethanol and dichloromethane. This compound is moderately reactive, particularly towards reduction and substitution reactions. It typically exists as a solid at room temperature and is stable under normal conditions but should be stored away from moisture and oxidizing agents.

About

CAS No 455-93-6
English Name 2-Fluoro-4-nitroanisole
Molecular Formula C7H6FNO3
Molecular Weight 171.13 g/mol
SMILES COC1=C(C=C(C=C1)[N+](=O)[O-])F
InChIKey XGMVTXUXZUPGGY-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

How is 2-Fluoro-4-nitroanisole (CAS: 455-93-6) typically synthesized?

2-Fluoro-4-nitroanisole (CAS: 455-93-6) is synthesized via the nitration of 2-fluoroanisole. This is...

Compound Q&A

What industries use 2-Fluoro-4-nitroanisole (CAS: 455-93-6)?

2-Fluoro-4-nitroanisole (CAS: 455-93-6) is used in various industries, particularly in pharmaceutica...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-4-nitroanisole (CAS: 455-93-6)?

When handling 2-Fluoro-4-nitroanisole (CAS: 455-93-6), it is crucial to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...