Compound Q&A

How is 2-Fluoro-4-nitroanisole (CAS: 455-93-6) typically synthesized?

Answer

2-Fluoro-4-nitroanisole
2-Fluoro-4-nitroanisole (CAS: 455-93-6) is synthesized via the nitration of 2-fluoroanisole. This is commonly achieved using nitric acid in the presence of sulfuric acid as a catalyst. The reaction is typically carried out at low temperatures to control the selectivity and yield. The product is then purified by recrystallization or other common purification techniques.

About

CAS No 455-93-6
English Name 2-Fluoro-4-nitroanisole
Molecular Formula C7H6FNO3
Molecular Weight 171.13 g/mol
SMILES COC1=C(C=C(C=C1)[N+](=O)[O-])F
InChIKey XGMVTXUXZUPGGY-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-4-nitroanisole (CAS: 455-93-6)?

2-Fluoro-4-nitroanisole (CAS: 455-93-6) is a crystalline solid with a molecular weight of approximat...

Compound Q&A

What industries use 2-Fluoro-4-nitroanisole (CAS: 455-93-6)?

2-Fluoro-4-nitroanisole (CAS: 455-93-6) is used in various industries, particularly in pharmaceutica...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-4-nitroanisole (CAS: 455-93-6)?

When handling 2-Fluoro-4-nitroanisole (CAS: 455-93-6), it is crucial to wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...