Compound Q&A

What industries use 6-Bromo-3-nitro-2-pyridinamine (CAS: 84487-04-7)?

Answer

6-Bromo-3-nitro-2-pyridinamine
6-Bromo-3-nitro-2-pyridinamine is utilized in various industries, including pharmaceuticals for the synthesis of drug intermediates, and in the chemical industry for the production of dyes and other organic compounds. It can also be applied in the development of sensors and as a reagent in analytical chemistry.

About

CAS No 84487-04-7
English Name 6-Bromo-3-nitro-2-pyridinamine
Molecular Formula C5H4BrN3O2
Molecular Weight 218.01 g/mol
SMILES NC1=NC(Br)=CC=C1[N+]([O-])=O
InChIKey YRXZIHANXVKUHP-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromo-3-nitro-2-pyridinamine (CAS: 84487-04-7)?

6-Bromo-3-nitro-2-pyridinamine is a crystalline solid with a molecular weight of approximately 228.0...

Compound Q&A

How is 6-Bromo-3-nitro-2-pyridinamine (CAS: 84487-04-7) typically synthesized?

6-Bromo-3-nitro-2-pyridinamine is typically synthesized through the bromination of 3-nitro-2-pyridin...

Compound Q&A

What precautions should be taken when handling 6-Bromo-3-nitro-2-pyridinamine (CAS: 84487-04-7)?

Handling 6-Bromo-3-nitro-2-pyridinamine requires appropriate personal protective equipment (PPE), in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...