Compound Q&A

What are the physical and chemical properties of 6-Bromo-3-nitro-2-pyridinamine (CAS: 84487-04-7)?

Answer

6-Bromo-3-nitro-2-pyridinamine
6-Bromo-3-nitro-2-pyridinamine is a crystalline solid with a molecular weight of approximately 228.04 g/mol. It is slightly soluble in water and has good solubility in common organic solvents such as methanol and acetone. This compound exhibits moderate reactivity, particularly towards nucleophilic substitution and reduction reactions.

About

CAS No 84487-04-7
English Name 6-Bromo-3-nitro-2-pyridinamine
Molecular Formula C5H4BrN3O2
Molecular Weight 218.01 g/mol
SMILES NC1=NC(Br)=CC=C1[N+]([O-])=O
InChIKey YRXZIHANXVKUHP-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

How is 6-Bromo-3-nitro-2-pyridinamine (CAS: 84487-04-7) typically synthesized?

6-Bromo-3-nitro-2-pyridinamine is typically synthesized through the bromination of 3-nitro-2-pyridin...

Compound Q&A

What industries use 6-Bromo-3-nitro-2-pyridinamine (CAS: 84487-04-7)?

6-Bromo-3-nitro-2-pyridinamine is utilized in various industries, including pharmaceuticals for the ...

Compound Q&A

What precautions should be taken when handling 6-Bromo-3-nitro-2-pyridinamine (CAS: 84487-04-7)?

Handling 6-Bromo-3-nitro-2-pyridinamine requires appropriate personal protective equipment (PPE), in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...