Compound Q&A

How is 6-Bromo-3-nitro-2-pyridinamine (CAS: 84487-04-7) typically synthesized?

Answer

6-Bromo-3-nitro-2-pyridinamine
6-Bromo-3-nitro-2-pyridinamine is typically synthesized through the bromination of 3-nitro-2-pyridinamine followed by a nitration reaction. Commonly, this involves the use of bromine in the presence of a Lewis acid catalyst and nitric acid for the nitration step, achieving good yields and selectivity under controlled conditions.

About

CAS No 84487-04-7
English Name 6-Bromo-3-nitro-2-pyridinamine
Molecular Formula C5H4BrN3O2
Molecular Weight 218.01 g/mol
SMILES NC1=NC(Br)=CC=C1[N+]([O-])=O
InChIKey YRXZIHANXVKUHP-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromo-3-nitro-2-pyridinamine (CAS: 84487-04-7)?

6-Bromo-3-nitro-2-pyridinamine is a crystalline solid with a molecular weight of approximately 228.0...

Compound Q&A

What industries use 6-Bromo-3-nitro-2-pyridinamine (CAS: 84487-04-7)?

6-Bromo-3-nitro-2-pyridinamine is utilized in various industries, including pharmaceuticals for the ...

Compound Q&A

What precautions should be taken when handling 6-Bromo-3-nitro-2-pyridinamine (CAS: 84487-04-7)?

Handling 6-Bromo-3-nitro-2-pyridinamine requires appropriate personal protective equipment (PPE), in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...