Compound Q&A

What industries use 2-Bromo-6-chloro-3-nitropyridine (CAS: 91678-23-8)?

Answer

2-Bromo-6-chloro-3-nitropyridine
2-Bromo-6-chloro-3-nitropyridine is used in pharmaceuticals for the synthesis of various drug intermediates. It is also utilized in the polymer industry for the preparation of functionalized polymers. Additionally, this compound can be employed in the development of sensors and semiconductors due to its unique chemical properties and reactivity.

About

CAS No 91678-23-8
English Name 2-Bromo-6-chloro-3-nitropyridine
Molecular Formula C5H2BrClN2O2
Molecular Weight 237.44 g/mol
SMILES C1=CC(=NC(=C1[N+](=O)[O-])Br)Cl
InChIKey WISCKHBEOBONJA-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-6-chloro-3-nitropyridine (CAS: 91678-23-8)?

2-Bromo-6-chloro-3-nitropyridine is a crystalline solid with a molecular weight of approximately 222...

Compound Q&A

How is 2-Bromo-6-chloro-3-nitropyridine (CAS: 91678-23-8) typically synthesized?

2-Bromo-6-chloro-3-nitropyridine is typically synthesized via electrophilic substitution reactions. ...

Compound Q&A

What precautions should be taken when handling 2-Bromo-6-chloro-3-nitropyridine (CAS: 91678-23-8)?

When handling 2-Bromo-6-chloro-3-nitropyridine, it is crucial to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...