Compound Q&A

What are the physical and chemical properties of 2-Bromo-6-chloro-3-nitropyridine (CAS: 91678-23-8)?

Answer

2-Bromo-6-chloro-3-nitropyridine
2-Bromo-6-chloro-3-nitropyridine is a crystalline solid with a molecular weight of approximately 222.01 g/mol. It is sparingly soluble in water but soluble in common organic solvents like ethanol and acetone. This compound is highly reactive due to its electron-withdrawing nitro group, making it a versatile intermediate in organic synthesis. It is prone to hydrolysis under basic conditions and can undergo substitution reactions at the bromo and chloro positions.

About

CAS No 91678-23-8
English Name 2-Bromo-6-chloro-3-nitropyridine
Molecular Formula C5H2BrClN2O2
Molecular Weight 237.44 g/mol
SMILES C1=CC(=NC(=C1[N+](=O)[O-])Br)Cl
InChIKey WISCKHBEOBONJA-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is 2-Bromo-6-chloro-3-nitropyridine (CAS: 91678-23-8) typically synthesized?

2-Bromo-6-chloro-3-nitropyridine is typically synthesized via electrophilic substitution reactions. ...

Compound Q&A

What industries use 2-Bromo-6-chloro-3-nitropyridine (CAS: 91678-23-8)?

2-Bromo-6-chloro-3-nitropyridine is used in pharmaceuticals for the synthesis of various drug interm...

Compound Q&A

What precautions should be taken when handling 2-Bromo-6-chloro-3-nitropyridine (CAS: 91678-23-8)?

When handling 2-Bromo-6-chloro-3-nitropyridine, it is crucial to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...