Compound Q&A

What industries use Disodium (2S)-2-aminosuccinate (CAS: 5598-53-8)?

Answer

Disodium (2S)-2-aminosuccinate
Disodium (2S)-2-aminosuccinate is widely used in the pharmaceutical industry for the synthesis of active pharmaceutical ingredients. It is also utilized in the polymer industry for modifying and enhancing the properties of polymers. Additionally, it finds applications in the production of sensors and semiconductors.

About

CAS No 5598-53-8
English Name Disodium (2S)-2-aminosuccinate
Molecular Formula C4H5NNa2O4
Molecular Weight 177.07 g/mol
SMILES C(C(C(=O)[O-])N)C(=O)[O-].[Na+].[Na+]
InChIKey XMXOIHIZTOVVFB-JIZZDEOASA-L
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Disodium (2S)-2-aminosuccinate (CAS: 5598-53-8)?

Disodium (2S)-2-aminosuccinate is a white to off-white crystalline powder with a molecular weight of...

Compound Q&A

How is Disodium (2S)-2-aminosuccinate (CAS: 5598-53-8) typically synthesized?

Disodium (2S)-2-aminosuccinate is commonly synthesized via the alkylation of sodium aminosuccinate w...

Compound Q&A

What precautions should be taken when handling Disodium (2S)-2-aminosuccinate (CAS: 5598-53-8)?

When handling Disodium (2S)-2-2-aminosuccinate, it is essential to wear appropriate personal protect...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...