Compound Q&A

What are the physical and chemical properties of Disodium (2S)-2-aminosuccinate (CAS: 5598-53-8)?

Answer

Disodium (2S)-2-aminosuccinate
Disodium (2S)-2-aminosuccinate is a white to off-white crystalline powder with a molecular weight of approximately 199.13 g/mol. It is slightly soluble in water and ethanol. The compound exhibits good reactivity towards amine groups, making it useful in various chemical transformations.

About

CAS No 5598-53-8
English Name Disodium (2S)-2-aminosuccinate
Molecular Formula C4H5NNa2O4
Molecular Weight 177.07 g/mol
SMILES C(C(C(=O)[O-])N)C(=O)[O-].[Na+].[Na+]
InChIKey XMXOIHIZTOVVFB-JIZZDEOASA-L
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is Disodium (2S)-2-aminosuccinate (CAS: 5598-53-8) typically synthesized?

Disodium (2S)-2-aminosuccinate is commonly synthesized via the alkylation of sodium aminosuccinate w...

Compound Q&A

What industries use Disodium (2S)-2-aminosuccinate (CAS: 5598-53-8)?

Disodium (2S)-2-aminosuccinate is widely used in the pharmaceutical industry for the synthesis of ac...

Compound Q&A

What precautions should be taken when handling Disodium (2S)-2-aminosuccinate (CAS: 5598-53-8)?

When handling Disodium (2S)-2-2-aminosuccinate, it is essential to wear appropriate personal protect...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...