Compound Q&A

How is Disodium (2S)-2-aminosuccinate (CAS: 5598-53-8) typically synthesized?

Answer

Disodium (2S)-2-aminosuccinate
Disodium (2S)-2-aminosuccinate is commonly synthesized via the alkylation of sodium aminosuccinate with sodium ethoxide. The reaction proceeds with high selectivity, yielding a high yield of the desired diastereomer. The process involves the use of organic solvents and requires careful control of reaction conditions.

About

CAS No 5598-53-8
English Name Disodium (2S)-2-aminosuccinate
Molecular Formula C4H5NNa2O4
Molecular Weight 177.07 g/mol
SMILES C(C(C(=O)[O-])N)C(=O)[O-].[Na+].[Na+]
InChIKey XMXOIHIZTOVVFB-JIZZDEOASA-L
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Disodium (2S)-2-aminosuccinate (CAS: 5598-53-8)?

Disodium (2S)-2-aminosuccinate is a white to off-white crystalline powder with a molecular weight of...

Compound Q&A

What industries use Disodium (2S)-2-aminosuccinate (CAS: 5598-53-8)?

Disodium (2S)-2-aminosuccinate is widely used in the pharmaceutical industry for the synthesis of ac...

Compound Q&A

What precautions should be taken when handling Disodium (2S)-2-aminosuccinate (CAS: 5598-53-8)?

When handling Disodium (2S)-2-2-aminosuccinate, it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...