Compound Q&A

What industries use 2-chloro-4,5-difluorobenzoic acid (CAS: 110877-64-0)?

Answer

2-chloro-4,5-difluorobenzoic acid
2-Chloro-4,5-difluorobenzoic acid is used in various industries, including pharmaceuticals for the synthesis of active pharmaceutical ingredients, in polymer science for modifying the properties of polymers, and in the production of sensors and semiconductors due to its unique chemical structure.

About

English Name 2-chloro-4,5-difluorobenzoic acid
Molecular Formula C7H3ClF2O2
Molecular Weight 192.55 g/mol
SMILES C1=C(C(=CC(=C1F)F)Cl)C(=O)O
InChIKey CGFMLBSNHNWJAW-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-chloro-4,5-difluorobenzoic acid (CAS: 110877-64-0)?

2-Chloro-4,5-difluorobenzoic acid is a crystalline solid with a molecular weight of approximately 21...

Compound Q&A

How is 2-chloro-4,5-difluorobenzoic acid (CAS: 110877-64-0) typically synthesized?

2-Chloro-4,5-difluorobenzoic acid is typically synthesized through the chlorination of 4,5-difluorob...

Compound Q&A

What precautions should be taken when handling 2-chloro-4,5-difluorobenzoic acid (CAS: 110877-64-0)?

When handling 2-chloro-4,5-difluorobenzoic acid, it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...