Compound Q&A

How is 2-chloro-4,5-difluorobenzoic acid (CAS: 110877-64-0) typically synthesized?

Answer

2-chloro-4,5-difluorobenzoic acid
2-Chloro-4,5-difluorobenzoic acid is typically synthesized through the chlorination of 4,5-difluorobenzoic acid using a Lewis acid catalyst such as aluminum chloride. The reaction involves the substitution of a chlorine atom at the 2-position of the benzene ring, providing a high yield and good selectivity.

About

English Name 2-chloro-4,5-difluorobenzoic acid
Molecular Formula C7H3ClF2O2
Molecular Weight 192.55 g/mol
SMILES C1=C(C(=CC(=C1F)F)Cl)C(=O)O
InChIKey CGFMLBSNHNWJAW-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-chloro-4,5-difluorobenzoic acid (CAS: 110877-64-0)?

2-Chloro-4,5-difluorobenzoic acid is a crystalline solid with a molecular weight of approximately 21...

Compound Q&A

What industries use 2-chloro-4,5-difluorobenzoic acid (CAS: 110877-64-0)?

2-Chloro-4,5-difluorobenzoic acid is used in various industries, including pharmaceuticals for the s...

Compound Q&A

What precautions should be taken when handling 2-chloro-4,5-difluorobenzoic acid (CAS: 110877-64-0)?

When handling 2-chloro-4,5-difluorobenzoic acid, it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...