Compound Q&A

What industries use 3-Nitrocinnamic Acid (CAS: 555-68-0)?

Answer

3-Nitrocinnamic Acid
3-Nitrocinnamic Acid (CAS: 555-68-0) is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It is also utilized in the polymer industry for its ability to enhance the properties of polymers. Additionally, it finds applications in sensor technology for selective detection of specific molecules. Its unique chemical properties also make it useful in semiconductor manufacturing for etching and other processes.

About

CAS No 555-68-0
English Name 3-Nitrocinnamic Acid
Molecular Formula C9H7NO4
Molecular Weight 193.16 g/mol
SMILES C1=CC(=CC(=C1)[N+](=O)[O-])C=CC(=O)O
InChIKey WWXMVRYHLZMQIG-SNAWJCMRSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Nitrocinnamic Acid (CAS: 555-68-0)?

3-Nitrocinnamic Acid (CAS: 555-68-0) is a crystalline solid with a molecular weight of approximately...

Compound Q&A

How is 3-Nitrocinnamic Acid (CAS: 555-68-0) typically synthesized?

3-Nitrocinnamic Acid can be synthesized through the nitration of cinnamic acid. A common method invo...

Compound Q&A

What precautions should be taken when handling 3-Nitrocinnamic Acid (CAS: 555-68-0)?

When handling 3-Nitrocinnamic Acid (CAS: 555-68-0), it is essential to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...