Compound Q&A

How is 3-Nitrocinnamic Acid (CAS: 555-68-0) typically synthesized?

Answer

3-Nitrocinnamic Acid
3-Nitrocinnamic Acid can be synthesized through the nitration of cinnamic acid. A common method involves the nitration of cinnamic acid with a mixture of concentrated nitric acid and sulfuric acid. The reaction is carried out under cooling to prevent excessive heating, leading to a yield of around 70-80%. The process requires careful handling due to the strong oxidizing nature of the nitric acid and the heat sensitivity of the intermediate products.

About

CAS No 555-68-0
English Name 3-Nitrocinnamic Acid
Molecular Formula C9H7NO4
Molecular Weight 193.16 g/mol
SMILES C1=CC(=CC(=C1)[N+](=O)[O-])C=CC(=O)O
InChIKey WWXMVRYHLZMQIG-SNAWJCMRSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Nitrocinnamic Acid (CAS: 555-68-0)?

3-Nitrocinnamic Acid (CAS: 555-68-0) is a crystalline solid with a molecular weight of approximately...

Compound Q&A

What industries use 3-Nitrocinnamic Acid (CAS: 555-68-0)?

3-Nitrocinnamic Acid (CAS: 555-68-0) is primarily used in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling 3-Nitrocinnamic Acid (CAS: 555-68-0)?

When handling 3-Nitrocinnamic Acid (CAS: 555-68-0), it is essential to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...