Compound Q&A

What are the physical and chemical properties of Adiphenine HCl Impurity 1 (2,2-Diphenylacetyl chloride) (CAS: 1871-76-7)?

Answer

Adiphenine HCl Impurity 1 (2,2-Diphenylacetyl chloride)
Adiphenine HCl Impurity 1 (CAS: 1871-76-7) is a crystalline solid with a molecular weight of approximately 277.24 g/mol. It is soluble in organic solvents such as ethanol and acetone. This compound exhibits limited reactivity, primarily through electrophilic aromatic substitution and acyl chloride addition reactions.

About

CAS No 1871-76-7
English Name Adiphenine HCl Impurity 1 (2,2-Diphenylacetyl chloride)
Molecular Formula C14H11ClO
Molecular Weight 230.69 g/mol
SMILES C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)Cl
InChIKey MSYLETHDEIJMAF-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is Adiphenine HCl Impurity 1 (2,2-Diphenylacetyl chloride) (CAS: 1871-76-7) typically synthesized?

Adiphenine HCl Impurity 1 (CAS: 1871-76-7) can be synthesized by reacting diphenylacetyl chloride wi...

Compound Q&A

What industries use Adiphenine HCl Impurity 1 (2,2-Diphenylacetyl chloride) (CAS: 1871-76-7)?

Adiphenine HCl Impurity 1 (CAS: 1871-76-7) is primarily used in pharmaceuticals and organic synthesi...

Compound Q&A

What precautions should be taken when handling Adiphenine HCl Impurity 1 (2,2-Diphenylacetyl chloride) (CAS: 1871-76-7)?

When handling Adiphenine HCl Impurity 1 (CAS: 1871-76-7), ensure the use of appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...