Compound Q&A

What are the physical and chemical properties of Amorolfinehydrochloride (CAS: 106614-68-0)?

Answer

Amorolfinehydrochloride
Amorolfinehydrochloride is a crystalline compound with a molecular weight of approximately 265.7 g/mol. It has a pKa of about 2.1 and is poorly soluble in water but soluble in organic solvents like methanol and ethanol. Amorolfinehydrochloride is less reactive than most carboxylic acids, showing limited reactivity in standard organic reactions. It is stable under normal storage conditions but may degrade under acidic or basic conditions.

About

English Name Amorolfinehydrochloride
Molecular Formula C21H36ClNO
Molecular Weight 354 g/mol
SMILES CCC(C)(C)C1=CC=C(C=C1)CC(C)CN2CC(OC(C2)C)C.Cl
InChIKey XZKWIPVTHGWDCF-KUZYQSSXSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is Amorolfinehydrochloride (CAS: 106614-68-0) typically synthesized?

Amorolfinehydrochloride is typically synthesized by the reaction of amorolfine with hydrochloric aci...

Compound Q&A

What industries use Amorolfinehydrochloride (CAS: 106614-68-0)?

Amorolfinehydrochloride is primarily used in the pharmaceutical industry for the treatment of nail i...

Compound Q&A

What precautions should be taken when handling Amorolfinehydrochloride (CAS: 106614-68-0)?

When handling Amorolfinehydrochloride, wear appropriate personal protective equipment (PPE), includi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...