Compound Q&A

What industries use 3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7)?

Answer

3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate
3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7) is used in various industries, including pharmaceuticals for its potential as a precursor in drug synthesis, and in polymers for its ability to enhance properties such as thermal stability. It is also utilized in sensor technology and semiconductor manufacturing due to its chemical reactivity and stability.

About

CAS No 597-71-7
English Name 3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate
Molecular Formula C13H20O8
Molecular Weight 304.3 g/mol
SMILES CC(=O)OCC(COC(=O)C)(COC(=O)C)COC(=O)C
InChIKey OUHCZCFQVONTOC-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7)?

3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7) is a crystalline solid with a molecul...

Compound Q&A

How is 3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7) typically synthesized?

3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7) can be synthesized through a multi-st...

Compound Q&A

What precautions should be taken when handling 3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7)?

When handling 3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7), it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...