Compound Q&A

How is 3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7) typically synthesized?

Answer

3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate
3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7) can be synthesized through a multi-step process involving the acetylation of a propyl acetoxy compound followed by a second acetylation step. The reaction typically requires the use of a dehydrating agent and a catalyst such as sulfuric acid. The yield is generally good, and the selectivity is high, making it suitable for various applications in organic chemistry.

About

CAS No 597-71-7
English Name 3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate
Molecular Formula C13H20O8
Molecular Weight 304.3 g/mol
SMILES CC(=O)OCC(COC(=O)C)(COC(=O)C)COC(=O)C
InChIKey OUHCZCFQVONTOC-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7)?

3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7) is a crystalline solid with a molecul...

Compound Q&A

What industries use 3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7)?

3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7) is used in various industries, includ...

Compound Q&A

What precautions should be taken when handling 3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7)?

When handling 3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7), it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...