Compound Q&A

What are the physical and chemical properties of 3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7)?

Answer

3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate
3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7) is a crystalline solid with a molecular weight of approximately 392.4 g/mol. It is poorly soluble in water but soluble in organic solvents such as ethanol and acetone. The compound is moderately reactive, particularly towards nucleophiles and bases. It is stable under normal conditions but should be stored in a cool, dry place away from strong acids and bases.

About

CAS No 597-71-7
English Name 3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate
Molecular Formula C13H20O8
Molecular Weight 304.3 g/mol
SMILES CC(=O)OCC(COC(=O)C)(COC(=O)C)COC(=O)C
InChIKey OUHCZCFQVONTOC-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is 3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7) typically synthesized?

3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7) can be synthesized through a multi-st...

Compound Q&A

What industries use 3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7)?

3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7) is used in various industries, includ...

Compound Q&A

What precautions should be taken when handling 3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7)?

When handling 3-Acetoxy-2,2-bis(acetoxymethyl)propyl acetate (CAS: 597-71-7), it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...