Compound Q&A

What industries use S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate (CAS: 76931-93-6)?

Answer

S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate
S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate finds applications in pharmaceuticals for its potential as a medicinal intermediate, in polymers for its use in functional materials, and in sensors for its reactivity with various analytes. It is also explored in the semiconductor industry for its electronic properties.

About

CAS No 76931-93-6
English Name S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate
Molecular Formula C8H9NO5S
Molecular Weight 231.23 g/mol
SMILES CC(=O)SCC(=O)ON1C(=O)CCC1=O
InChIKey FLCQLSRLQIPNLM-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate (CAS: 76931-93-6)?

S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate is a crystalline compound with a mole...

Compound Q&A

How is S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate (CAS: 76931-93-6) typically synthesized?

S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate is synthesized by the condensation re...

Compound Q&A

What precautions should be taken when handling S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate (CAS: 76931-93-6)?

When handling S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate, it is crucial to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...