Compound Q&A

What are the physical and chemical properties of S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate (CAS: 76931-93-6)?

Answer

S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate
S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate is a crystalline compound with a molecular weight of approximately 290.33 g/mol. It has low solubility in water but is soluble in organic solvents. It exhibits reactivity similar to other thiols and can undergo nucleophilic substitution reactions. Its stability is moderate under normal conditions.

About

CAS No 76931-93-6
English Name S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate
Molecular Formula C8H9NO5S
Molecular Weight 231.23 g/mol
SMILES CC(=O)SCC(=O)ON1C(=O)CCC1=O
InChIKey FLCQLSRLQIPNLM-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

How is S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate (CAS: 76931-93-6) typically synthesized?

S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate is synthesized by the condensation re...

Compound Q&A

What industries use S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate (CAS: 76931-93-6)?

S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate finds applications in pharmaceuticals...

Compound Q&A

What precautions should be taken when handling S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate (CAS: 76931-93-6)?

When handling S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate, it is crucial to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...