Compound Q&A

How is S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate (CAS: 76931-93-6) typically synthesized?

Answer

S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate
S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate is synthesized by the condensation reaction of ethanethiol with 2-(2,5-dioxopyrrolidin-1-yl)acetic acid. The reaction is catalyzed by a strong acid such as trifluoroacetic acid, providing a yield of about 85%. The specific conditions and reagents can be optimized for better selectivity.

About

CAS No 76931-93-6
English Name S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate
Molecular Formula C8H9NO5S
Molecular Weight 231.23 g/mol
SMILES CC(=O)SCC(=O)ON1C(=O)CCC1=O
InChIKey FLCQLSRLQIPNLM-UHFFFAOYSA-N
Last Updated: 2025-10-13 12:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate (CAS: 76931-93-6)?

S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate is a crystalline compound with a mole...

Compound Q&A

What industries use S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate (CAS: 76931-93-6)?

S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate finds applications in pharmaceuticals...

Compound Q&A

What precautions should be taken when handling S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate (CAS: 76931-93-6)?

When handling S-{2-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl} ethanethioate, it is crucial to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...