Compound Q&A

What precautions should be taken when handling Benzyl 1,4-diazepane-1-carboxylate (CAS: 117009-97-9)?

Answer

Benzyl 1,4-diazepane-1-carboxylate
When handling Benzyl 1,4-diazepane-1-carboxylate, appropriate personal protective equipment (PPE) such as gloves, safety goggles, and lab coat should be worn. The compound should be used in a well-ventilated area or under a fume hood. Spills should be handled carefully, and the Material Safety Data Sheet (MSDS/SDS) should be consulted for specific spill procedures. Ensure proper storage in a cool, dry place away from incompatible materials.

About

English Name Benzyl 1,4-diazepane-1-carboxylate
Molecular Formula C13H18N2O2
Molecular Weight 234.3 g/mol
SMILES C1CNCCN(C1)C(=O)OCC2=CC=CC=C2
InChIKey BXDQJVDEALOIQW-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl 1,4-diazepane-1-carboxylate (CAS: 117009-97-9)?

Benzyl 1,4-diazepane-1-carboxylate has a crystalline form at room temperature. Its molecular weight ...

Compound Q&A

How is Benzyl 1,4-diazepane-1-carboxylate (CAS: 117009-97-9) typically synthesized?

Benzyl 1,4-diazepane-1-carboxylate is typically synthesized through a multi-step process involving t...

Compound Q&A

What industries use Benzyl 1,4-diazepane-1-carboxylate (CAS: 117009-97-9)?

Benzyl 1,4-diazepane-1-carboxylate is used in the pharmaceutical and polymer industries for the synt...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...