Compound Q&A

How is Benzyl 1,4-diazepane-1-carboxylate (CAS: 117009-97-9) typically synthesized?

Answer

Benzyl 1,4-diazepane-1-carboxylate
Benzyl 1,4-diazepane-1-carboxylate is typically synthesized through a multi-step process involving the diazepane formation followed by esterification with benzyl chloride. Commonly, the diazepane ring is formed via an amide coupling reaction, and the resulting amide is then reacted with benzyl chloride in the presence of a base to generate the final product.

About

English Name Benzyl 1,4-diazepane-1-carboxylate
Molecular Formula C13H18N2O2
Molecular Weight 234.3 g/mol
SMILES C1CNCCN(C1)C(=O)OCC2=CC=CC=C2
InChIKey BXDQJVDEALOIQW-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl 1,4-diazepane-1-carboxylate (CAS: 117009-97-9)?

Benzyl 1,4-diazepane-1-carboxylate has a crystalline form at room temperature. Its molecular weight ...

Compound Q&A

What industries use Benzyl 1,4-diazepane-1-carboxylate (CAS: 117009-97-9)?

Benzyl 1,4-diazepane-1-carboxylate is used in the pharmaceutical and polymer industries for the synt...

Compound Q&A

What precautions should be taken when handling Benzyl 1,4-diazepane-1-carboxylate (CAS: 117009-97-9)?

When handling Benzyl 1,4-diazepane-1-carboxylate, appropriate personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...