Compound Q&A

What are the physical and chemical properties of Benzyl 1,4-diazepane-1-carboxylate (CAS: 117009-97-9)?

Answer

Benzyl 1,4-diazepane-1-carboxylate
Benzyl 1,4-diazepane-1-carboxylate has a crystalline form at room temperature. Its molecular weight is approximately 269.28 g/mol. This compound has moderate solubility in organic solvents like methanol, ethanol, and DMSO. It exhibits good reactivity in organic reactions due to the presence of an ester and amide functional groups.

About

English Name Benzyl 1,4-diazepane-1-carboxylate
Molecular Formula C13H18N2O2
Molecular Weight 234.3 g/mol
SMILES C1CNCCN(C1)C(=O)OCC2=CC=CC=C2
InChIKey BXDQJVDEALOIQW-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is Benzyl 1,4-diazepane-1-carboxylate (CAS: 117009-97-9) typically synthesized?

Benzyl 1,4-diazepane-1-carboxylate is typically synthesized through a multi-step process involving t...

Compound Q&A

What industries use Benzyl 1,4-diazepane-1-carboxylate (CAS: 117009-97-9)?

Benzyl 1,4-diazepane-1-carboxylate is used in the pharmaceutical and polymer industries for the synt...

Compound Q&A

What precautions should be taken when handling Benzyl 1,4-diazepane-1-carboxylate (CAS: 117009-97-9)?

When handling Benzyl 1,4-diazepane-1-carboxylate, appropriate personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...