Compound Q&A

What industries use Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8)?

Answer

Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate
Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8) is primarily used in the pharmaceutical industry for the synthesis of various compounds, as a precursor in polymer chemistry for the development of new materials, and in the production of sensors and semiconductors. Its unique chemical properties make it valuable in these applications.

About

English Name Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate
Molecular Formula C14H24O6
Molecular Weight 288.34 g/mol
SMILES COC1(CC(C1)(C(=O)OC(C)C)C(=O)OC(C)C)OC
InChIKey SZJMXTBKYMLPTJ-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8)?

Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8) is a colorless or yellowis...

Compound Q&A

How is Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8) typically synthesized?

Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8) can be synthesized by the ...

Compound Q&A

What precautions should be taken when handling Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8)?

When handling Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8), it is cruci...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...