Compound Q&A

How is Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8) typically synthesized?

Answer

Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate
Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8) can be synthesized by the reaction of diisopropyl acetals with dimethyl oxalate. The process often involves refluxing these reactants in the presence of a mild base like sodium hydroxide. The yield is typically around 75-85%, and the reaction is highly selective, producing the desired product with minimal side products.

About

English Name Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate
Molecular Formula C14H24O6
Molecular Weight 288.34 g/mol
SMILES COC1(CC(C1)(C(=O)OC(C)C)C(=O)OC(C)C)OC
InChIKey SZJMXTBKYMLPTJ-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8)?

Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8) is a colorless or yellowis...

Compound Q&A

What industries use Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8)?

Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8) is primarily used in the p...

Compound Q&A

What precautions should be taken when handling Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8)?

When handling Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8), it is cruci...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...