Compound Q&A

What are the physical and chemical properties of Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8)?

Answer

Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate
Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8) is a colorless or yellowish liquid with a molecular weight of approximately 284.43 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and acetonitrile. The compound is moderately reactive, particularly in esterification reactions. It crystallizes easily from certain solvents and is stable under normal storage conditions.

About

English Name Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate
Molecular Formula C14H24O6
Molecular Weight 288.34 g/mol
SMILES COC1(CC(C1)(C(=O)OC(C)C)C(=O)OC(C)C)OC
InChIKey SZJMXTBKYMLPTJ-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8) typically synthesized?

Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8) can be synthesized by the ...

Compound Q&A

What industries use Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8)?

Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8) is primarily used in the p...

Compound Q&A

What precautions should be taken when handling Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8)?

When handling Diisopropyl 3,3-dimethoxy-1,1-cyclobutanedicarboxylate (CAS: 115118-68-8), it is cruci...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...