Compound Q&A

What precautions should be taken when handling (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methoxy-4-oxobutanoic acid (CAS: 145038-52-4)?

Answer

(3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methoxy-4-oxobutanoic acid
When handling this compound, it is essential to use gloves, goggles, and a lab coat to protect against skin contact and inhalation. Ensure that all manipulations are conducted in a fume hood to minimize exposure. Spills should be cleaned up with caution using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed information on proper handling and emergency procedures.

About

English Name (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methoxy-4-oxobutanoic acid
Molecular Formula C20H19NO6
Molecular Weight 369.37 g/mol
SMILES COC(=O)C(CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
InChIKey UEUZUMRMWJUEMK-KRWDZBQOSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methoxy-4-oxobutanoic acid (CAS: 145038-52-4)?

This compound is a colorless crystalline solid with a molecular weight of approximately 458.46 g/mol...

Compound Q&A

How is (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methoxy-4-oxobutanoic acid (CAS: 145038-52-4) typically synthesized?

This compound is typically synthesized through multi-step reactions, starting with the coupling of f...

Compound Q&A

What industries use (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methoxy-4-oxobutanoic acid (CAS: 145038-52-4)?

This compound is used in the pharmaceutical industry for the synthesis of certain bioactive compound...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...