Compound Q&A

What are the physical and chemical properties of (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methoxy-4-oxobutanoic acid (CAS: 145038-52-4)?

Answer

(3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methoxy-4-oxobutanoic acid
This compound is a colorless crystalline solid with a molecular weight of approximately 458.46 g/mol. It exhibits moderate solubility in common organic solvents like methanol and ethanol. Chemically, it is reactive towards nucleophiles and undergoes hydrolysis under basic conditions. It is stable under normal storage conditions but should be stored away from moisture and strong acids.

About

English Name (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methoxy-4-oxobutanoic acid
Molecular Formula C20H19NO6
Molecular Weight 369.37 g/mol
SMILES COC(=O)C(CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
InChIKey UEUZUMRMWJUEMK-KRWDZBQOSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methoxy-4-oxobutanoic acid (CAS: 145038-52-4) typically synthesized?

This compound is typically synthesized through multi-step reactions, starting with the coupling of f...

Compound Q&A

What industries use (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methoxy-4-oxobutanoic acid (CAS: 145038-52-4)?

This compound is used in the pharmaceutical industry for the synthesis of certain bioactive compound...

Compound Q&A

What precautions should be taken when handling (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methoxy-4-oxobutanoic acid (CAS: 145038-52-4)?

When handling this compound, it is essential to use gloves, goggles, and a lab coat to protect again...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...