Compound Q&A

What industries use (2R)-Amino(3,5-dinitrophenyl)acetic acid (CAS: 74927-72-3)?

Answer

(2R)-Amino(3,5-dinitrophenyl)acetic acid
(2R)-Amino(3,5-dinitrophenyl)acetic acid is primarily used in the pharmaceutical industry for the synthesis of various organic compounds and intermediates. It can also be applied in the polymer industry for the development of functional polymers, and in the sensor industry for the production of chemical sensors due to its unique reactivity.

About

CAS No 74927-72-3
English Name (2R)-Amino(3,5-dinitrophenyl)acetic acid
Molecular Formula C8H7N3O6
Molecular Weight 345.26 g/mol
SMILES OC(=O)[C@H](NC(=O)c1cc(cc(c1)[N+](=O)[O-])[N+](=O)[O-])c2ccccc2
InChIKey UVOWPSUNIJUNGB-SSDOTTSWSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-Amino(3,5-dinitrophenyl)acetic acid (CAS: 74927-72-3)?

(2R)-Amino(3,5-dinitrophenyl)acetic acid is a crystalline solid with a molecular weight of approxima...

Compound Q&A

How is (2R)-Amino(3,5-dinitrophenyl)acetic acid (CAS: 74927-72-3) typically synthesized?

(2R)-Amino(3,5-dinitrophenyl)acetic acid can be synthesized via the coupling of 3,5-dinitrobenzoic a...

Compound Q&A

What precautions should be taken when handling (2R)-Amino(3,5-dinitrophenyl)acetic acid (CAS: 74927-72-3)?

When handling (2R)-Amino(3,5-dinitrophenyl)acetic acid, proper personal protective equipment (PPE) s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...