Compound Q&A

How is (2R)-Amino(3,5-dinitrophenyl)acetic acid (CAS: 74927-72-3) typically synthesized?

Answer

(2R)-Amino(3,5-dinitrophenyl)acetic acid
(2R)-Amino(3,5-dinitrophenyl)acetic acid can be synthesized via the coupling of 3,5-dinitrobenzoic acid and glycine. The reaction typically involves the use of a condensing reagent such as dicyclohexylcarbodiimide (DCC) and 4-(dimethylamino)pyridine (DMAP) as a catalyst. The yield is usually around 70-80%, and the product is isolated by recrystallization.

About

CAS No 74927-72-3
English Name (2R)-Amino(3,5-dinitrophenyl)acetic acid
Molecular Formula C8H7N3O6
Molecular Weight 345.26 g/mol
SMILES OC(=O)[C@H](NC(=O)c1cc(cc(c1)[N+](=O)[O-])[N+](=O)[O-])c2ccccc2
InChIKey UVOWPSUNIJUNGB-SSDOTTSWSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-Amino(3,5-dinitrophenyl)acetic acid (CAS: 74927-72-3)?

(2R)-Amino(3,5-dinitrophenyl)acetic acid is a crystalline solid with a molecular weight of approxima...

Compound Q&A

What industries use (2R)-Amino(3,5-dinitrophenyl)acetic acid (CAS: 74927-72-3)?

(2R)-Amino(3,5-dinitrophenyl)acetic acid is primarily used in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling (2R)-Amino(3,5-dinitrophenyl)acetic acid (CAS: 74927-72-3)?

When handling (2R)-Amino(3,5-dinitrophenyl)acetic acid, proper personal protective equipment (PPE) s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...