Compound Q&A

What are the physical and chemical properties of (3S)-1-[(4-Methylphenyl)sulfonyl]-3-pyrrolidinyl}(diphenyl)acetonitrile (CAS: 133099-09-9)?

Answer

{(3S)-1-[(4-Methylphenyl)sulfonyl]-3-pyrrolidinyl}(diphenyl)acetonitrile
The physical properties of (3S)-1-[(4-Methylphenyl)sulfonyl]-3-pyrrolidinyl}(diphenyl)acetonitrile include a crystalline form with a molecular weight of approximately 565.65 g/mol. It has low water solubility but good solubility in organic solvents such as dimethylformamide and acetonitrile. Chemically, it is moderately reactive, particularly towards nucleophiles and can undergo acylation reactions with good yield.

About

English Name {(3S)-1-[(4-Methylphenyl)sulfonyl]-3-pyrrolidinyl}(diphenyl)acetonitrile
Molecular Formula C25H24N2O2S
Molecular Weight 416.5 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)N2CCC(C2)C(C#N)(C3=CC=CC=C3)C4=CC=CC=C4
InChIKey XPQZNOFTICUMIN-HSZRJFAPSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is (3S)-1-[(4-Methylphenyl)sulfonyl]-3-pyrrolidinyl}(diphenyl)acetonitrile (CAS: 133099-09-9) typically synthesized?

This compound is typically synthesized via the condensation of (4-methylphenyl)sulfonyl chloride wit...

Compound Q&A

What industries use (3S)-1-[(4-Methylphenyl)sulfonyl]-3-pyrrolidinyl}(diphenyl)acetonitrile (CAS: 133099-09-9)?

This compound is used in various industries, including pharmaceuticals for developing specific drug ...

Compound Q&A

What precautions should be taken when handling (3S)-1-[(4-Methylphenyl)sulfonyl]-3-pyrrolidinyl}(diphenyl)acetonitrile (CAS: 133099-09-9)?

Proper personal protective equipment (PPE) is essential when handling this compound, including glove...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...