Compound Q&A

What precautions should be taken when handling (7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid (CAS: 106562-32-7)?

Answer

(7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid
When handling (7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid, wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to avoid inhalation. Spills should be cleaned up with caution, using appropriate absorbents. Always refer to the safety data sheet (SDS) for detailed safety information.

About

English Name (7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid
Molecular Formula C12H11NO4
Molecular Weight 233.22 g/mol
SMILES CC1=C(C(=O)OC2=C1C=CC(=C2)N)CC(=O)O
InChIKey QEQDLKUMPUDNPG-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid (CAS: 106562-32-7)?

(7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid is a white crystalline solid with a molecular we...

Compound Q&A

How is (7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid (CAS: 106562-32-7) typically synthesized?

(7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid can be synthesized through a multi-step process ...

Compound Q&A

What industries use (7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid (CAS: 106562-32-7)?

(7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid is primarily used in the pharmaceutical industry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...