Compound Q&A

What are the physical and chemical properties of (7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid (CAS: 106562-32-7)?

Answer

(7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid
(7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid is a white crystalline solid with a molecular weight of approximately 236.2 g/mol. It has a solubility in water of about 30 mg/mL. Chemically, it is stable, but it can react with strong acids or bases to form corresponding salts. It is used in pharmaceutical applications and has good reactivity with other functional groups.

About

English Name (7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid
Molecular Formula C12H11NO4
Molecular Weight 233.22 g/mol
SMILES CC1=C(C(=O)OC2=C1C=CC(=C2)N)CC(=O)O
InChIKey QEQDLKUMPUDNPG-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is (7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid (CAS: 106562-32-7) typically synthesized?

(7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid can be synthesized through a multi-step process ...

Compound Q&A

What industries use (7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid (CAS: 106562-32-7)?

(7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling (7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid (CAS: 106562-32-7)?

When handling (7-Amino-4-methyl-2-oxo-2H-chromen-3-yl)acetic acid, wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...