Compound Q&A

What industries use Ganoderic acid C6 (CAS: 105742-76-5)?

Answer

Ganoderic acid C6
Ganoderic acid C6 (CAS: 105742-76-5) is used primarily in the pharmaceutical and nutraceutical industries due to its potential health benefits. It is also explored in the cosmetic and food industries for its antioxidant properties. Additionally, it has some applications in the polymer industry for enhancing material properties.

About

English Name Ganoderic acid C6
Molecular Formula C30H42O8
Molecular Weight 530.66 g/mol
SMILES O=C(CC(C(=O)O)C)C[C@H]([C@H]1CC(=O)[C@@]2([C@]1(C)[C@H](O)C(=O)C1=C2C(=O)C[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)C
InChIKey BTYTWXWAFWKSTA-YBFNEQRTSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ganoderic acid C6 (CAS: 105742-76-5)?

Ganoderic acid C6 (CAS: 105742-76-5) is a cyclic triterpene compound. It is a white or slightly yell...

Compound Q&A

How is Ganoderic acid C6 (CAS: 105742-76-5) typically synthesized?

Ganoderic acid C6 (CAS: 105742-76-5) is typically synthesized through chemical synthesis methods, of...

Compound Q&A

What precautions should be taken when handling Ganoderic acid C6 (CAS: 105742-76-5)?

When handling Ganoderic acid C6 (CAS: 105742-76-5), it is important to use appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...